C27H38N6O3S — CID 139463613
4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid (PubChem CID 139463613) has the molecular formula C27H38N6O3S and a molecular weight of 526.71 g/mol. Its IUPAC name is 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463613 |
| Molecular Formula | C27H38N6O3S |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-methylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid |
| SMILES | COC(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncnc2sc(C)cc12)C(=O)O |
| InChI | InChI=1S/C27H38N6O3S/c1-18(36-3)16-33(13-5-4-8-21-10-9-20-7-6-12-28-24(20)31-21)14-11-23(27(34)35)32-25-22-15-19(2)37-26(22)30-17-29-25/h9-10,15,17-18,23H,4-8,11-14,16H2,1-3H3,(H,28,31)(H,34,35)(H,29,30,32) |
| InChIKey | XHEURWHMASHVBH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|