C28H38N6O3 — CID 139463503
4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinoxalin-2-ylamino)butanoic acid (PubChem CID 139463503) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinoxalin-2-ylamino)butanoic acid.
| Compound Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinoxalin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463503 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinoxalin-2-ylamino)butanoic acid |
| SMILES | COC(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1cnc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C28H38N6O3/c1-20(37-2)19-34(16-6-5-9-22-13-12-21-8-7-15-29-27(21)31-22)17-14-25(28(35)36)33-26-18-30-23-10-3-4-11-24(23)32-26/h3-4,10-13,18,20,25H,5-9,14-17,19H2,1-2H3,(H,29,31)(H,32,33)(H,35,36) |
| InChIKey | OYZDQAFHRSXMQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|