C26H41N7O3 — CID 139463996
(2S)-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463996) has the molecular formula C26H41N7O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is (2S)-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463996 |
| Molecular Formula | C26H41N7O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | (2S)-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | CO[C@H](C)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1cc(N(C)C)ncn1)C(=O)O |
| InChI | InChI=1S/C26H41N7O3/c1-19(36-4)17-33(14-6-5-9-21-11-10-20-8-7-13-27-25(20)30-21)15-12-22(26(34)35)31-23-16-24(32(2)3)29-18-28-23/h10-11,16,18-19,22H,5-9,12-15,17H2,1-4H3,(H,27,30)(H,34,35)(H,28,29,31)/t19-,22+/m1/s1 |
| InChIKey | SXCMGOMVKZUNMQ-KNQAVFIVSA-N |
| XLogP | 2.91 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|