C31H41N5O3 — CID 139464273
4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid (PubChem CID 139464273) has the molecular formula C31H41N5O3 and a molecular weight of 531.70 g/mol. Its IUPAC name is 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464273 |
| Molecular Formula | C31H41N5O3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid |
| SMILES | COC(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1cc(-c2ccccc2)ccn1)C(=O)O |
| InChI | InChI=1S/C31H41N5O3/c1-23(39-2)22-36(19-7-6-12-27-14-13-25-11-8-17-33-30(25)34-27)20-16-28(31(37)38)35-29-21-26(15-18-32-29)24-9-4-3-5-10-24/h3-5,9-10,13-15,18,21,23,28H,6-8,11-12,16-17,19-20,22H2,1-2H3,(H,32,35)(H,33,34)(H,37,38) |
| InChIKey | RYDFSMFKOFPQTH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|