C34H47FN6O3 — CID 139481539
2-methylpropyl (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoate (PubChem CID 139481539) has the molecular formula C34H47FN6O3 and a molecular weight of 606.79 g/mol. Its IUPAC name is 2-methylpropyl (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoate.
| Compound Name | 2-methylpropyl (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoate |
|---|---|
| PubChem CID | 139481539 |
| Molecular Formula | C34H47FN6O3 |
| Molecular Weight | 606.79 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 2-methylpropyl (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoate |
| SMILES | COC[C@@H](F)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1cc(-c2ccncc2)ccn1)C(=O)OCC(C)C |
| InChI | InChI=1S/C34H47FN6O3/c1-25(2)23-44-34(42)31(40-32-21-28(13-18-37-32)26-11-16-36-17-12-26)14-20-41(22-29(35)24-43-3)19-5-4-8-30-10-9-27-7-6-15-38-33(27)39-30/h9-13,16-18,21,25,29,31H,4-8,14-15,19-20,22-24H2,1-3H3,(H,37,40)(H,38,39)/t29-,31-/m0/s1 |
| InChIKey | CFYNCXUORQVXJW-SMCANUKXSA-N |
| XLogP | 5.58 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.79 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|