C25H37N5O3 — CID 139463466
4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid (PubChem CID 139463466) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid.
| Compound Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463466 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 4-[2-methoxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
| SMILES | COC(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ccccn1)C(=O)O |
| InChI | InChI=1S/C25H37N5O3/c1-19(33-2)18-30(17-13-22(25(31)32)29-23-10-3-5-14-26-23)16-6-4-9-21-12-11-20-8-7-15-27-24(20)28-21/h3,5,10-12,14,19,22H,4,6-9,13,15-18H2,1-2H3,(H,26,29)(H,27,28)(H,31,32) |
| InChIKey | VMNGPCQZRGYFKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|