C28H40N4O5 — CID 139463789
(2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 139463789) has the molecular formula C28H40N4O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 139463789 |
| Molecular Formula | C28H40N4O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CO[C@H](C)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H40N4O5/c1-21(36-2)19-32(17-7-6-12-24-14-13-23-11-8-16-29-26(23)30-24)18-15-25(27(33)34)31-28(35)37-20-22-9-4-3-5-10-22/h3-5,9-10,13-14,21,25H,6-8,11-12,15-20H2,1-2H3,(H,29,30)(H,31,35)(H,33,34)/t21-,25+/m1/s1 |
| InChIKey | PGLWDUMYQCCUEN-BWKNWUBXSA-N |
| XLogP | 3.87 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|