C27H50N4O4 — CID 176962818
2-acetamido-4-[2-propan-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid;ethane (PubChem CID 176962818) has the molecular formula C27H50N4O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is 2-acetamido-4-[2-propan-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid;ethane.
| Compound Name | 2-acetamido-4-[2-propan-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid;ethane |
|---|---|
| PubChem CID | 176962818 |
| Molecular Formula | C27H50N4O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | 2-acetamido-4-[2-propan-2-yloxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid;ethane |
| SMILES | CC.CC.CC(=O)NC(CCN(CCCCc1ccc2c(n1)NCCC2)CCOC(C)C)C(=O)O |
| InChI | InChI=1S/C23H38N4O4.2C2H6/c1-17(2)31-16-15-27(14-11-21(23(29)30)25-18(3)28)13-5-4-8-20-10-9-19-7-6-12-24-22(19)26-20;2*1-2/h9-10,17,21H,4-8,11-16H2,1-3H3,(H,24,26)(H,25,28)(H,29,30);2*1-2H3 |
| InChIKey | OAKXDAJOFFMLES-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|