C27H36F2N4O4 — CID 139463603
4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 139463603) has the molecular formula C27H36F2N4O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 139463603 |
| Molecular Formula | C27H36F2N4O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(NC(CCN(CCCCc1ccc2c(n1)NCCC2)CCC(F)F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C27H36F2N4O4/c28-24(29)14-18-33(16-5-4-10-22-12-11-21-9-6-15-30-25(21)31-22)17-13-23(26(34)35)32-27(36)37-19-20-7-2-1-3-8-20/h1-3,7-8,11-12,23-24H,4-6,9-10,13-19H2,(H,30,31)(H,32,36)(H,34,35) |
| InChIKey | CYTIFLKTUBUJNR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|