C30H39FN6O3 — CID 139463305
4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139463305) has the molecular formula C30H39FN6O3 and a molecular weight of 550.68 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463305 |
| Molecular Formula | C30H39FN6O3 |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.31 |
| IUPAC Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ccnc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C30H39FN6O3/c1-40-21-24(31)20-37(18-6-5-11-25-13-12-23-10-7-16-32-28(23)34-25)19-15-26(30(38)39)35-27-14-17-33-29(36-27)22-8-3-2-4-9-22/h2-4,8-9,12-14,17,24,26H,5-7,10-11,15-16,18-21H2,1H3,(H,32,34)(H,38,39)(H,33,35,36) |
| InChIKey | ZDAUIBRGNKJFHQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|