C34H41N7O3 — CID 139467842
(2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139467842) has the molecular formula C34H41N7O3 and a molecular weight of 595.75 g/mol. Its IUPAC name is (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139467842 |
| Molecular Formula | C34H41N7O3 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | (2S)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | Cc1ncccc1OCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ccnc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C34H41N7O3/c1-25-30(13-8-18-35-25)44-24-23-41(21-6-5-12-28-15-14-27-11-7-19-36-32(27)38-28)22-17-29(34(42)43)39-31-16-20-37-33(40-31)26-9-3-2-4-10-26/h2-4,8-10,13-16,18,20,29H,5-7,11-12,17,19,21-24H2,1H3,(H,36,38)(H,42,43)(H,37,39,40)/t29-/m0/s1 |
| InChIKey | WVLKYVNRBMRGCC-LJAQVGFWSA-N |
| XLogP | 5.26 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|