C29H39N7O3 — CID 139467925
(2S)-2-[(6-methylpyrazin-2-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139467925) has the molecular formula C29H39N7O3 and a molecular weight of 533.68 g/mol. Its IUPAC name is (2S)-2-[(6-methylpyrazin-2-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(6-methylpyrazin-2-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139467925 |
| Molecular Formula | C29H39N7O3 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (2S)-2-[(6-methylpyrazin-2-yl)amino]-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | Cc1cncc(N[C@@H](CCN(CCCCc2ccc3c(n2)NCCC3)CCOc2cccnc2C)C(=O)O)n1 |
| InChI | InChI=1S/C29H39N7O3/c1-21-19-30-20-27(33-21)35-25(29(37)38)12-16-36(17-18-39-26-9-6-13-31-22(26)2)15-4-3-8-24-11-10-23-7-5-14-32-28(23)34-24/h6,9-11,13,19-20,25H,3-5,7-8,12,14-18H2,1-2H3,(H,32,34)(H,33,35)(H,37,38)/t25-/m0/s1 |
| InChIKey | LRALJLUSKRXNFS-VWLOTQADSA-N |
| XLogP | 3.90 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|