C29H39N7O4 — CID 139467653
(2S)-2-[(2-methoxypyrimidin-4-yl)amino]-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139467653) has the molecular formula C29H39N7O4 and a molecular weight of 549.68 g/mol. Its IUPAC name is (2S)-2-[(2-methoxypyrimidin-4-yl)amino]-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(2-methoxypyrimidin-4-yl)amino]-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139467653 |
| Molecular Formula | C29H39N7O4 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (2S)-2-[(2-methoxypyrimidin-4-yl)amino]-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | COc1nccc(N[C@@H](CCN(CCCCc2ccc3c(n2)NCCC3)CCOc2ccc(C)nc2)C(=O)O)n1 |
| InChI | InChI=1S/C29H39N7O4/c1-21-8-11-24(20-32-21)40-19-18-36(16-4-3-7-23-10-9-22-6-5-14-30-27(22)33-23)17-13-25(28(37)38)34-26-12-15-31-29(35-26)39-2/h8-12,15,20,25H,3-7,13-14,16-19H2,1-2H3,(H,30,33)(H,37,38)(H,31,34,35)/t25-/m0/s1 |
| InChIKey | WOQHZMYJNGIIHJ-VWLOTQADSA-N |
| XLogP | 3.60 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|