C35H42N6O3 — CID 156690259
4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid (PubChem CID 156690259) has the molecular formula C35H42N6O3 and a molecular weight of 594.76 g/mol. Its IUPAC name is 4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 156690259 |
| Molecular Formula | C35H42N6O3 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | 4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid |
| SMILES | Cc1ccc(OCCN(CCCCc2ccc3c(n2)NCCC3)CCC(Nc2ccc(-c3ccccc3)cn2)C(=O)O)cn1 |
| InChI | InChI=1S/C35H42N6O3/c1-26-12-16-31(25-37-26)44-23-22-41(20-6-5-11-30-15-13-28-10-7-19-36-34(28)39-30)21-18-32(35(42)43)40-33-17-14-29(24-38-33)27-8-3-2-4-9-27/h2-4,8-9,12-17,24-25,32H,5-7,10-11,18-23H2,1H3,(H,36,39)(H,38,40)(H,42,43) |
| InChIKey | FAULCNJJLDKNLY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|