C35H44N7O3+ — CID 174153055
(3S)-3-[(3-hydroxy-5-phenylpyrimidin-3-ium-4-yl)amino]-5-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one (PubChem CID 174153055) has the molecular formula C35H44N7O3+ and a molecular weight of 610.78 g/mol. Its IUPAC name is (3S)-3-[(3-hydroxy-5-phenylpyrimidin-3-ium-4-yl)amino]-5-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one.
| Compound Name | (3S)-3-[(3-hydroxy-5-phenylpyrimidin-3-ium-4-yl)amino]-5-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one |
|---|---|
| PubChem CID | 174153055 |
| Molecular Formula | C35H44N7O3+ |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | (3S)-3-[(3-hydroxy-5-phenylpyrimidin-3-ium-4-yl)amino]-5-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]pentan-2-one |
| SMILES | CC(=O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1ccc(C)nc1)Nc1c(-c2ccccc2)cnc[n+]1O |
| InChI | InChI=1S/C35H43N7O3/c1-26-13-16-31(23-38-26)45-22-21-41(19-7-6-12-30-15-14-29-11-8-18-37-34(29)39-30)20-17-33(27(2)43)40-35-32(24-36-25-42(35)44)28-9-4-3-5-10-28/h3-5,9-10,13-16,23-25,33,44H,6-8,11-12,17-22H2,1-2H3,(H,37,39)/p+1/t33-/m0/s1 |
| InChIKey | DGLYTNXILXWNEK-XIFFEERXSA-O |
| XLogP | 4.89 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|