C28H40N7O3+ — CID 174153150
(3S)-5-[(2-hydroxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxypyrido[3,2-d]pyrimidin-3-ium-4-yl)amino]pentan-2-one (PubChem CID 174153150) has the molecular formula C28H40N7O3+ and a molecular weight of 522.67 g/mol. Its IUPAC name is (3S)-5-[(2-hydroxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxypyrido[3,2-d]pyrimidin-3-ium-4-yl)amino]pentan-2-one.
| Compound Name | (3S)-5-[(2-hydroxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxypyrido[3,2-d]pyrimidin-3-ium-4-yl)amino]pentan-2-one |
|---|---|
| PubChem CID | 174153150 |
| Molecular Formula | C28H40N7O3+ |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | (3S)-5-[(2-hydroxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxypyrido[3,2-d]pyrimidin-3-ium-4-yl)amino]pentan-2-one |
| SMILES | CC(=O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(C)(C)O)Nc1c2ncccc2nc[n+]1O |
| InChI | InChI=1S/C28H39N7O3/c1-20(36)23(33-27-25-24(10-7-14-29-25)31-19-35(27)38)13-17-34(18-28(2,3)37)16-5-4-9-22-12-11-21-8-6-15-30-26(21)32-22/h7,10-12,14,19,23,37-38H,4-6,8-9,13,15-18H2,1-3H3,(H,30,32)/p+1/t23-/m0/s1 |
| InChIKey | VRJLKBFBQDLOAP-QHCPKHFHSA-O |
| XLogP | 2.76 |
| TPSA | 127.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|