C26H36F5N6O3+ — CID 174207392
(3S)-5-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[[1-hydroxy-5-(trifluoromethyl)pyrimidin-1-ium-2-yl]amino]pentan-2-one (PubChem CID 174207392) has the molecular formula C26H36F5N6O3+ and a molecular weight of 575.60 g/mol. Its IUPAC name is (3S)-5-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[[1-hydroxy-5-(trifluoromethyl)pyrimidin-1-ium-2-yl]amino]pentan-2-one.
| Compound Name | (3S)-5-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[[1-hydroxy-5-(trifluoromethyl)pyrimidin-1-ium-2-yl]amino]pentan-2-one |
|---|---|
| PubChem CID | 174207392 |
| Molecular Formula | C26H36F5N6O3+ |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | (3S)-5-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[[1-hydroxy-5-(trifluoromethyl)pyrimidin-1-ium-2-yl]amino]pentan-2-one |
| SMILES | CC(=O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1ncc(C(F)(F)F)c[n+]1O |
| InChI | InChI=1S/C26H35F5N6O3/c1-18(38)22(35-25-33-15-20(16-37(25)39)26(29,30)31)9-12-36(13-14-40-17-23(27)28)11-3-2-6-21-8-7-19-5-4-10-32-24(19)34-21/h7-8,15-16,22-23,39H,2-6,9-14,17H2,1H3,(H,32,34)/p+1/t22-/m0/s1 |
| InChIKey | ITCHWLKRVWEOIY-QFIPXVFZSA-O |
| XLogP | 3.74 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|