C25H34F3N7O3 — CID 139464439
(2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 139464439) has the molecular formula C25H34F3N7O3 and a molecular weight of 537.59 g/mol. Its IUPAC name is (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464439 |
| Molecular Formula | C25H34F3N7O3 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (2S)-4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | CC(=O)NCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncc(C(F)(F)F)cn1)C(=O)O |
| InChI | InChI=1S/C25H34F3N7O3/c1-17(36)29-11-14-35(12-3-2-6-20-8-7-18-5-4-10-30-22(18)33-20)13-9-21(23(37)38)34-24-31-15-19(16-32-24)25(26,27)28/h7-8,15-16,21H,2-6,9-14H2,1H3,(H,29,36)(H,30,33)(H,37,38)(H,31,32,34)/t21-/m0/s1 |
| InChIKey | IRWQYFZQWZFBNR-NRFANRHFSA-N |
| XLogP | 2.96 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|