C25H33F5N6O3 — CID 139463617
(2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 139463617) has the molecular formula C25H33F5N6O3 and a molecular weight of 560.57 g/mol. Its IUPAC name is (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463617 |
| Molecular Formula | C25H33F5N6O3 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H33F5N6O3/c26-21(27)16-39-13-12-36(10-2-1-5-19-7-6-17-4-3-9-31-22(17)34-19)11-8-20(23(37)38)35-24-32-14-18(15-33-24)25(28,29)30/h6-7,14-15,20-21H,1-5,8-13,16H2,(H,31,34)(H,37,38)(H,32,33,35)/t20-/m0/s1 |
| InChIKey | DGZTYPUGRITPCN-FQEVSTJZSA-N |
| XLogP | 4.11 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|