C28H39N6O3+ — CID 174208406
(3S)-5-[3-hydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxyquinazolin-3-ium-4-yl)amino]pentan-2-one (PubChem CID 174208406) has the molecular formula C28H39N6O3+ and a molecular weight of 507.66 g/mol. Its IUPAC name is (3S)-5-[3-hydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxyquinazolin-3-ium-4-yl)amino]pentan-2-one.
| Compound Name | (3S)-5-[3-hydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxyquinazolin-3-ium-4-yl)amino]pentan-2-one |
|---|---|
| PubChem CID | 174208406 |
| Molecular Formula | C28H39N6O3+ |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (3S)-5-[3-hydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-3-[(3-hydroxyquinazolin-3-ium-4-yl)amino]pentan-2-one |
| SMILES | CC(=O)[C@H](CCN(CCCO)CCCCc1ccc2c(n1)NCCC2)Nc1c2ccccc2nc[n+]1O |
| InChI | InChI=1S/C28H38N6O3/c1-21(36)25(32-28-24-10-2-3-11-26(24)30-20-34(28)37)14-18-33(17-7-19-35)16-5-4-9-23-13-12-22-8-6-15-29-27(22)31-23/h2-3,10-13,20,25,35,37H,4-9,14-19H2,1H3,(H,29,31)/p+1/t25-/m0/s1 |
| InChIKey | VOUPXXYMFMAELT-VWLOTQADSA-O |
| XLogP | 2.98 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|