C31H38N6O4 — CID 139468049
2-(1,3-benzoxazol-2-ylamino)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139468049) has the molecular formula C31H38N6O4 and a molecular weight of 558.68 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139468049 |
| Molecular Formula | C31H38N6O4 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-4-[2-[(2-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | Cc1ncccc1OCCN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C31H38N6O4/c1-22-27(12-7-16-32-22)40-21-20-37(18-5-4-9-24-14-13-23-8-6-17-33-29(23)34-24)19-15-26(30(38)39)36-31-35-25-10-2-3-11-28(25)41-31/h2-3,7,10-14,16,26H,4-6,8-9,15,17-21H2,1H3,(H,33,34)(H,35,36)(H,38,39) |
| InChIKey | LVUXXCHQGFDEKS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|