C28H39N7O3 — CID 139464522
4-[(2-methoxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464522) has the molecular formula C28H39N7O3 and a molecular weight of 521.67 g/mol. Its IUPAC name is 4-[(2-methoxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | 4-[(2-methoxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464522 |
| Molecular Formula | C28H39N7O3 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 4-[(2-methoxy-2-methylpropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | COC(C)(C)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncnc2ncccc12)C(=O)O |
| InChI | InChI=1S/C28H39N7O3/c1-28(2,38-3)18-35(16-5-4-9-21-12-11-20-8-6-14-29-24(20)33-21)17-13-23(27(36)37)34-26-22-10-7-15-30-25(22)31-19-32-26/h7,10-12,15,19,23H,4-6,8-9,13-14,16-18H2,1-3H3,(H,29,33)(H,36,37)(H,30,31,32,34) |
| InChIKey | HZBNETUSWVPVGZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|