C34H38F2N6O3 — CID 139463454
(2S)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139463454) has the molecular formula C34H38F2N6O3 and a molecular weight of 616.71 g/mol. Its IUPAC name is (2S)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463454 |
| Molecular Formula | C34H38F2N6O3 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | (2S)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1ncncc1-c1ccccc1 |
| InChI | InChI=1S/C34H38F2N6O3/c35-26-19-27(36)21-29(20-26)45-18-17-42(15-5-4-10-28-12-11-25-9-6-14-38-32(25)40-28)16-13-31(34(43)44)41-33-30(22-37-23-39-33)24-7-2-1-3-8-24/h1-3,7-8,11-12,19-23,31H,4-6,9-10,13-18H2,(H,38,40)(H,43,44)(H,37,39,41)/t31-/m0/s1 |
| InChIKey | ATWHDCKUPIEKAG-HKBQPEDESA-N |
| XLogP | 5.83 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|