C31H38F2N6O3 — CID 139464135
(2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139464135) has the molecular formula C31H38F2N6O3 and a molecular weight of 580.68 g/mol. Its IUPAC name is (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464135 |
| Molecular Formula | C31H38F2N6O3 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1ncc(C2CC2)cn1 |
| InChI | InChI=1S/C31H38F2N6O3/c32-24-16-25(33)18-27(17-24)42-15-14-39(12-2-1-5-26-9-8-22-4-3-11-34-29(22)37-26)13-10-28(30(40)41)38-31-35-19-23(20-36-31)21-6-7-21/h8-9,16-21,28H,1-7,10-15H2,(H,34,37)(H,40,41)(H,35,36,38)/t28-/m0/s1 |
| InChIKey | SMOUFUVGVQQPHS-NDEPHWFRSA-N |
| XLogP | 5.04 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|