C29H36F3N7O3 — CID 139481183
(2S)-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid (PubChem CID 139481183) has the molecular formula C29H36F3N7O3 and a molecular weight of 587.65 g/mol. Its IUPAC name is (2S)-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139481183 |
| Molecular Formula | C29H36F3N7O3 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | (2S)-4-[2-[(6-methyl-3-pyridinyl)oxy]ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
| SMILES | Cc1ccc(OCCN(CCCCc2ccc3c(n2)NCCC3)CC[C@H](Nc2cc(C(F)(F)F)ncn2)C(=O)O)cn1 |
| InChI | InChI=1S/C29H36F3N7O3/c1-20-7-10-23(18-34-20)42-16-15-39(13-3-2-6-22-9-8-21-5-4-12-33-27(21)37-22)14-11-24(28(40)41)38-26-17-25(29(30,31)32)35-19-36-26/h7-10,17-19,24H,2-6,11-16H2,1H3,(H,33,37)(H,40,41)(H,35,36,38)/t24-/m0/s1 |
| InChIKey | KQBXBQRRMNEFNB-DEOSSOPVSA-N |
| XLogP | 4.61 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|