C27H37F2N7O3 — CID 159680433
(2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]butanoic acid (PubChem CID 159680433) has the molecular formula C27H37F2N7O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 159680433 |
| Molecular Formula | C27H37F2N7O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-[(1-methylpyrazolo[3,4-d]pyrimidin-4-yl)amino]butanoic acid |
| SMILES | Cn1ncc2c(N[C@@H](CCN(CCCCc3ccc4c(n3)CCCC4)CCOCC(F)F)C(=O)O)ncnc21 |
| InChI | InChI=1S/C27H37F2N7O3/c1-35-26-21(16-32-35)25(30-18-31-26)34-23(27(37)38)11-13-36(14-15-39-17-24(28)29)12-5-4-7-20-10-9-19-6-2-3-8-22(19)33-20/h9-10,16,18,23-24H,2-8,11-15,17H2,1H3,(H,37,38)(H,30,31,34)/t23-/m0/s1 |
| InChIKey | XYMPBFMNCKFQHD-QHCPKHFHSA-N |
| XLogP | 3.50 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|