C29H38N4O3 — CID 160653467
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-(quinolin-4-ylamino)butanoic acid (PubChem CID 160653467) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-(quinolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-(quinolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 160653467 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butyl]amino]-2-(quinolin-4-ylamino)butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)CCCC2)CC[C@H](Nc1ccnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H38N4O3/c1-36-21-20-33(18-7-6-9-23-14-13-22-8-2-4-11-25(22)31-23)19-16-28(29(34)35)32-27-15-17-30-26-12-5-3-10-24(26)27/h3,5,10,12-15,17,28H,2,4,6-9,11,16,18-21H2,1H3,(H,30,32)(H,34,35)/t28-/m0/s1 |
| InChIKey | AENQLNUCILZIPI-NDEPHWFRSA-N |
| XLogP | 4.74 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|