C29H41N5O3 — CID 153342672
methyl 4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]-2-(quinolin-4-ylamino)butanoate (PubChem CID 153342672) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is methyl 4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]-2-(quinolin-4-ylamino)butanoate.
| Compound Name | methyl 4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]-2-(quinolin-4-ylamino)butanoate |
|---|---|
| PubChem CID | 153342672 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | methyl 4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]-2-(quinolin-4-ylamino)butanoate |
| SMILES | CCc1ccc(CCCCN(CCOC)CCC(Nc2ccnc3ccccc23)C(=O)OC)nc1NC |
| InChI | InChI=1S/C29H41N5O3/c1-5-22-13-14-23(32-28(22)30-2)10-8-9-18-34(20-21-36-3)19-16-27(29(35)37-4)33-26-15-17-31-25-12-7-6-11-24(25)26/h6-7,11-15,17,27H,5,8-10,16,18-21H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | JWDQMZJMJCQYAO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|