C24H43N5O4 — CID 176963005
2-(diethylcarbamoylamino)-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoic acid (PubChem CID 176963005) has the molecular formula C24H43N5O4 and a molecular weight of 465.64 g/mol. Its IUPAC name is 2-(diethylcarbamoylamino)-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoic acid.
| Compound Name | 2-(diethylcarbamoylamino)-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 176963005 |
| Molecular Formula | C24H43N5O4 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.33 |
| IUPAC Name | 2-(diethylcarbamoylamino)-4-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl-(2-methoxyethyl)amino]butanoic acid |
| SMILES | CCc1ccc(CCCCN(CCOC)CCC(NC(=O)N(CC)CC)C(=O)O)nc1NC |
| InChI | InChI=1S/C24H43N5O4/c1-6-19-12-13-20(26-22(19)25-4)11-9-10-15-28(17-18-33-5)16-14-21(23(30)31)27-24(32)29(7-2)8-3/h12-13,21H,6-11,14-18H2,1-5H3,(H,25,26)(H,27,32)(H,30,31) |
| InChIKey | FGINOICYDOMDAT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|