C19H31F2N3O2 — CID 166106837
methyl 4-[2,2-difluoroethyl-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl]amino]butanoate (PubChem CID 166106837) has the molecular formula C19H31F2N3O2 and a molecular weight of 371.47 g/mol. Its IUPAC name is methyl 4-[2,2-difluoroethyl-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl]amino]butanoate.
| Compound Name | methyl 4-[2,2-difluoroethyl-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl]amino]butanoate |
|---|---|
| PubChem CID | 166106837 |
| Molecular Formula | C19H31F2N3O2 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | methyl 4-[2,2-difluoroethyl-[4-[5-ethyl-6-(methylamino)-2-pyridinyl]butyl]amino]butanoate |
| SMILES | CCc1ccc(CCCCN(CCCC(=O)OC)CC(F)F)nc1NC |
| InChI | InChI=1S/C19H31F2N3O2/c1-4-15-10-11-16(23-19(15)22-2)8-5-6-12-24(14-17(20)21)13-7-9-18(25)26-3/h10-11,17H,4-9,12-14H2,1-3H3,(H,22,23) |
| InChIKey | IZKBNKMLSXMPFO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|