methyl 5-(1,8-naphthyridin-2-yl)pentanoate

C14H16N2O2 — CID 11447926

IUPACmethyl 5-(1,8-naphthyridin-2-yl)pentanoate
SMILESCOC(=O)CCCCc1ccc2cccnc2n1
InChIInChI=1S/C14H16N2O2/c1-18-13(17)7-3-2-6-12-9-8-11-5-4-10-15-14(11)16-12/h4-5,8-10H,2-3,6-7H2,1H3
InChIKeyODIRTESTHMGHKQ-UHFFFAOYSA-N
MW244.29 g/mol
LogP2.52
Rot. Bonds5

About methyl 5-(1,8-naphthyridin-2-yl)pentanoate

methyl 5-(1,8-naphthyridin-2-yl)pentanoate (PubChem CID 11447926) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 5-(1,8-naphthyridin-2-yl)pentanoate.

Molecular Properties

Compound Namemethyl 5-(1,8-naphthyridin-2-yl)pentanoate
PubChem CID11447926
Molecular FormulaC14H16N2O2
Molecular Weight244.29 g/mol
Exact Mass244.12
IUPAC Namemethyl 5-(1,8-naphthyridin-2-yl)pentanoate
SMILESCOC(=O)CCCCc1ccc2cccnc2n1
InChIInChI=1S/C14H16N2O2/c1-18-13(17)7-3-2-6-12-9-8-11-5-4-10-15-14(11)16-12/h4-5,8-10H,2-3,6-7H2,1H3
InChIKeyODIRTESTHMGHKQ-UHFFFAOYSA-N
XLogP2.52
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 52.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(1,8-naphthyridin-2-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,8-naphthyridin-2-yl)pentanoate?
The IUPAC name of methyl 5-(1,8-naphthyridin-2-yl)pentanoate (CID 11447926) is methyl 5-(1,8-naphthyridin-2-yl)pentanoate.
What is the SMILES notation for methyl 5-(1,8-naphthyridin-2-yl)pentanoate?
The canonical SMILES for methyl 5-(1,8-naphthyridin-2-yl)pentanoate is COC(=O)CCCCc1ccc2cccnc2n1.
What is the InChIKey of methyl 5-(1,8-naphthyridin-2-yl)pentanoate?
The InChIKey is ODIRTESTHMGHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-18-13(17)7-3-2-6-12-9-8-11-5-4-10-15-14(11)16-12/h4-5,8-10H,2-3,6-7H2,1H3.
What are the key properties of methyl 5-(1,8-naphthyridin-2-yl)pentanoate?
methyl 5-(1,8-naphthyridin-2-yl)pentanoate has a molecular weight of 244.29 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,8-naphthyridin-2-yl)pentanoate is sourced from PubChem (CID 11447926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).