C12H12N2O2 — CID 25419194
4-(1,8-naphthyridin-2-yl)butanoic acid (PubChem CID 25419194) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-(1,8-naphthyridin-2-yl)butanoic acid.
| Compound Name | 4-(1,8-naphthyridin-2-yl)butanoic acid |
|---|---|
| PubChem CID | 25419194 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-(1,8-naphthyridin-2-yl)butanoic acid |
| SMILES | O=C(O)CCCc1ccc2cccnc2n1 |
| InChI | InChI=1S/C12H12N2O2/c15-11(16)5-1-4-10-7-6-9-3-2-8-13-12(9)14-10/h2-3,6-8H,1,4-5H2,(H,15,16) |
| InChIKey | HFBITYXPNVQAGU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |