4-(1,8-naphthyridin-2-yl)butanoic acid

C12H12N2O2 — CID 25419194

IUPAC4-(1,8-naphthyridin-2-yl)butanoic acid
SMILESO=C(O)CCCc1ccc2cccnc2n1
InChIInChI=1S/C12H12N2O2/c15-11(16)5-1-4-10-7-6-9-3-2-8-13-12(9)14-10/h2-3,6-8H,1,4-5H2,(H,15,16)
InChIKeyHFBITYXPNVQAGU-UHFFFAOYSA-N
MW216.24 g/mol
LogP2.04
Rot. Bonds4

About 4-(1,8-naphthyridin-2-yl)butanoic acid

4-(1,8-naphthyridin-2-yl)butanoic acid (PubChem CID 25419194) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-(1,8-naphthyridin-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(1,8-naphthyridin-2-yl)butanoic acid
PubChem CID25419194
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Name4-(1,8-naphthyridin-2-yl)butanoic acid
SMILESO=C(O)CCCc1ccc2cccnc2n1
InChIInChI=1S/C12H12N2O2/c15-11(16)5-1-4-10-7-6-9-3-2-8-13-12(9)14-10/h2-3,6-8H,1,4-5H2,(H,15,16)
InChIKeyHFBITYXPNVQAGU-UHFFFAOYSA-N
XLogP2.04
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(1,8-naphthyridin-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(1,8-naphthyridin-2-yl)butanoic acid?
The IUPAC name of 4-(1,8-naphthyridin-2-yl)butanoic acid (CID 25419194) is 4-(1,8-naphthyridin-2-yl)butanoic acid.
What is the SMILES notation for 4-(1,8-naphthyridin-2-yl)butanoic acid?
The canonical SMILES for 4-(1,8-naphthyridin-2-yl)butanoic acid is O=C(O)CCCc1ccc2cccnc2n1.
What is the InChIKey of 4-(1,8-naphthyridin-2-yl)butanoic acid?
The InChIKey is HFBITYXPNVQAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-11(16)5-1-4-10-7-6-9-3-2-8-13-12(9)14-10/h2-3,6-8H,1,4-5H2,(H,15,16).
What are the key properties of 4-(1,8-naphthyridin-2-yl)butanoic acid?
4-(1,8-naphthyridin-2-yl)butanoic acid has a molecular weight of 216.24 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,8-naphthyridin-2-yl)butanoic acid is sourced from PubChem (CID 25419194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).