C28H30N4O2 — CID 169205451
ethane;3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzamide (PubChem CID 169205451) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethane;3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzamide.
| Compound Name | ethane;3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 169205451 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | ethane;3-[4-[[4-(1,8-naphthyridin-2-yl)butanoylamino]methyl]phenyl]benzamide |
| SMILES | CC.NC(=O)c1cccc(-c2ccc(CNC(=O)CCCc3ccc4cccnc4n3)cc2)c1 |
| InChI | InChI=1S/C26H24N4O2.C2H6/c27-25(32)22-5-1-4-21(16-22)19-11-9-18(10-12-19)17-29-24(31)8-2-7-23-14-13-20-6-3-15-28-26(20)30-23;1-2/h1,3-6,9-16H,2,7-8,17H2,(H2,27,32)(H,29,31);1-2H3 |
| InChIKey | WMFYXLLQNPMQCT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |