C17H23N5O2 — CID 144774247
ethane;5-oxo-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]hexanamide (PubChem CID 144774247) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethane;5-oxo-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]hexanamide.
| Compound Name | ethane;5-oxo-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 144774247 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | ethane;5-oxo-N-[[4-(1,2,4,5-tetrazin-3-yl)phenyl]methyl]hexanamide |
| SMILES | CC.CC(=O)CCCC(=O)NCc1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C15H17N5O2.C2H6/c1-11(21)3-2-4-14(22)16-9-12-5-7-13(8-6-12)15-19-17-10-18-20-15;1-2/h5-8,10H,2-4,9H2,1H3,(H,16,22);1-2H3 |
| InChIKey | IEJSSYSMFJZYSL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |