ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid

C15H20N2O2 — CID 162436158

IUPACethane;5-(1,8-naphthyridin-2-yl)pentanoic acid
SMILESCC.O=C(O)CCCCc1ccc2cccnc2n1
InChIInChI=1S/C13H14N2O2.C2H6/c16-12(17)6-2-1-5-11-8-7-10-4-3-9-14-13(10)15-11;1-2/h3-4,7-9H,1-2,5-6H2,(H,16,17);1-2H3
InChIKeyZPWOAOJDIJMCQS-UHFFFAOYSA-N
MW260.34 g/mol
LogP3.45
Rot. Bonds5

About ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid

ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid (PubChem CID 162436158) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid.

Molecular Properties

Compound Nameethane;5-(1,8-naphthyridin-2-yl)pentanoic acid
PubChem CID162436158
Molecular FormulaC15H20N2O2
Molecular Weight260.34 g/mol
Exact Mass260.15
IUPAC Nameethane;5-(1,8-naphthyridin-2-yl)pentanoic acid
SMILESCC.O=C(O)CCCCc1ccc2cccnc2n1
InChIInChI=1S/C13H14N2O2.C2H6/c16-12(17)6-2-1-5-11-8-7-10-4-3-9-14-13(10)15-11;1-2/h3-4,7-9H,1-2,5-6H2,(H,16,17);1-2H3
InChIKeyZPWOAOJDIJMCQS-UHFFFAOYSA-N
XLogP3.45
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.34
LogP ≤ 53.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid?
The IUPAC name of ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid (CID 162436158) is ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid.
What is the SMILES notation for ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid?
The canonical SMILES for ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid is CC.O=C(O)CCCCc1ccc2cccnc2n1.
What is the InChIKey of ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid?
The InChIKey is ZPWOAOJDIJMCQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2.C2H6/c16-12(17)6-2-1-5-11-8-7-10-4-3-9-14-13(10)15-11;1-2/h3-4,7-9H,1-2,5-6H2,(H,16,17);1-2H3.
What are the key properties of ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid?
ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid has a molecular weight of 260.34 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(1,8-naphthyridin-2-yl)pentanoic acid is sourced from PubChem (CID 162436158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).