C25H27N3O2 — CID 22570279
3-[5-[3-(1,8-naphthyridin-2-yl)propyl]indol-1-yl]hexanoic acid (PubChem CID 22570279) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[5-[3-(1,8-naphthyridin-2-yl)propyl]indol-1-yl]hexanoic acid.
| Compound Name | 3-[5-[3-(1,8-naphthyridin-2-yl)propyl]indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 22570279 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[5-[3-(1,8-naphthyridin-2-yl)propyl]indol-1-yl]hexanoic acid |
| SMILES | CCCC(CC(=O)O)n1ccc2cc(CCCc3ccc4cccnc4n3)ccc21 |
| InChI | InChI=1S/C25H27N3O2/c1-2-5-22(17-24(29)30)28-15-13-20-16-18(9-12-23(20)28)6-3-8-21-11-10-19-7-4-14-26-25(19)27-21/h4,7,9-16,22H,2-3,5-6,8,17H2,1H3,(H,29,30) |
| InChIKey | DWZFKMFJUQOCHM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |