C24H31N3O3 — CID 142158782
3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]indol-1-yl]octanoic acid (PubChem CID 142158782) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]indol-1-yl]octanoic acid.
| Compound Name | 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]indol-1-yl]octanoic acid |
|---|---|
| PubChem CID | 142158782 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]indol-1-yl]octanoic acid |
| SMILES | CCCCCC(CC(=O)O)n1ccc2cc(OCCc3cccc(NC)n3)ccc21 |
| InChI | InChI=1S/C24H31N3O3/c1-3-4-5-8-20(17-24(28)29)27-14-12-18-16-21(10-11-22(18)27)30-15-13-19-7-6-9-23(25-2)26-19/h6-7,9-12,14,16,20H,3-5,8,13,15,17H2,1-2H3,(H,25,26)(H,28,29) |
| InChIKey | ORIRCUOLCMZEDQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|