C21H29N3O3 — CID 70191089
(3R)-3-(6-methoxy-3-pyridinyl)-9-[6-(methylamino)-2-pyridinyl]nonanoic acid (PubChem CID 70191089) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is (3R)-3-(6-methoxy-3-pyridinyl)-9-[6-(methylamino)-2-pyridinyl]nonanoic acid.
| Compound Name | (3R)-3-(6-methoxy-3-pyridinyl)-9-[6-(methylamino)-2-pyridinyl]nonanoic acid |
|---|---|
| PubChem CID | 70191089 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (3R)-3-(6-methoxy-3-pyridinyl)-9-[6-(methylamino)-2-pyridinyl]nonanoic acid |
| SMILES | CNc1cccc(CCCCCC[C@H](CC(=O)O)c2ccc(OC)nc2)n1 |
| InChI | InChI=1S/C21H29N3O3/c1-22-19-11-7-10-18(24-19)9-6-4-3-5-8-16(14-21(25)26)17-12-13-20(27-2)23-15-17/h7,10-13,15-16H,3-6,8-9,14H2,1-2H3,(H,22,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | RZEZFXHVGHLDQK-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|