C22H27N3O3 — CID 90903976
3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]-1H-indol-2-yl]hexanoic acid (PubChem CID 90903976) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]-1H-indol-2-yl]hexanoic acid.
| Compound Name | 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]-1H-indol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 90903976 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-[5-[2-[6-(methylamino)-2-pyridinyl]ethoxy]-1H-indol-2-yl]hexanoic acid |
| SMILES | CCCC(CC(=O)O)c1cc2cc(OCCc3cccc(NC)n3)ccc2[nH]1 |
| InChI | InChI=1S/C22H27N3O3/c1-3-5-15(14-22(26)27)20-13-16-12-18(8-9-19(16)25-20)28-11-10-17-6-4-7-21(23-2)24-17/h4,6-9,12-13,15,25H,3,5,10-11,14H2,1-2H3,(H,23,24)(H,26,27) |
| InChIKey | QUUQXNSSLQQBTL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |