C20H24N2O3 — CID 54281184
methyl 3-methyl-4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]but-3-enoate (PubChem CID 54281184) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 3-methyl-4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]but-3-enoate.
| Compound Name | methyl 3-methyl-4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]but-3-enoate |
|---|---|
| PubChem CID | 54281184 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl 3-methyl-4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]but-3-enoate |
| SMILES | CNc1cccc(CCOc2ccc(C=C(C)CC(=O)OC)cc2)n1 |
| InChI | InChI=1S/C20H24N2O3/c1-15(14-20(23)24-3)13-16-7-9-18(10-8-16)25-12-11-17-5-4-6-19(21-2)22-17/h4-10,13H,11-12,14H2,1-3H3,(H,21,22) |
| InChIKey | RQWVXEOOYSWNFP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |