C26H30N2O3 — CID 141013948
ethyl 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]-2-phenylbutanoate (PubChem CID 141013948) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]-2-phenylbutanoate.
| Compound Name | ethyl 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]-2-phenylbutanoate |
|---|---|
| PubChem CID | 141013948 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]-2-phenylbutanoate |
| SMILES | CCOC(=O)C(CCc1ccc(OCCc2cccc(NC)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O3/c1-3-30-26(29)24(21-8-5-4-6-9-21)17-14-20-12-15-23(16-13-20)31-19-18-22-10-7-11-25(27-2)28-22/h4-13,15-16,24H,3,14,17-19H2,1-2H3,(H,27,28) |
| InChIKey | RVRNOCSIUQNACZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |