C19H24N2O3 — CID 142102612
4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]pentanoic acid (PubChem CID 142102612) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]pentanoic acid.
| Compound Name | 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 142102612 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-[4-[2-[6-(methylamino)-2-pyridinyl]ethoxy]phenyl]pentanoic acid |
| SMILES | CNc1cccc(CCOc2ccc(C(C)CCC(=O)O)cc2)n1 |
| InChI | InChI=1S/C19H24N2O3/c1-14(6-11-19(22)23)15-7-9-17(10-8-15)24-13-12-16-4-3-5-18(20-2)21-16/h3-5,7-10,14H,6,11-13H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | BMRUNZNFVIWBNK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |