C17H22N2O — CID 107668066
6-[(4-butan-2-ylphenoxy)methyl]-N-methylpyridin-2-amine (PubChem CID 107668066) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 6-[(4-butan-2-ylphenoxy)methyl]-N-methylpyridin-2-amine.
| Compound Name | 6-[(4-butan-2-ylphenoxy)methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107668066 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 6-[(4-butan-2-ylphenoxy)methyl]-N-methylpyridin-2-amine |
| SMILES | CCC(C)c1ccc(OCc2cccc(NC)n2)cc1 |
| InChI | InChI=1S/C17H22N2O/c1-4-13(2)14-8-10-16(11-9-14)20-12-15-6-5-7-17(18-3)19-15/h5-11,13H,4,12H2,1-3H3,(H,18,19) |
| InChIKey | CTTJWALJRIDBHU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |