C13H16N2 — CID 11481079
2-pentyl-1,8-naphthyridine (PubChem CID 11481079) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-pentyl-1,8-naphthyridine.
| Compound Name | 2-pentyl-1,8-naphthyridine |
|---|---|
| PubChem CID | 11481079 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-pentyl-1,8-naphthyridine |
| SMILES | CCCCCc1ccc2cccnc2n1 |
| InChI | InChI=1S/C13H16N2/c1-2-3-4-7-12-9-8-11-6-5-10-14-13(11)15-12/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | UTNVYZGZIFKNGN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|