C15H25N — CID 58097448
2,6-dipentylpyridine (PubChem CID 58097448) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2,6-dipentylpyridine.
| Compound Name | 2,6-dipentylpyridine |
|---|---|
| PubChem CID | 58097448 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2,6-dipentylpyridine |
| SMILES | CCCCCc1cccc(CCCCC)n1 |
| InChI | InChI=1S/C15H25N/c1-3-5-7-10-14-12-9-13-15(16-14)11-8-6-4-2/h9,12-13H,3-8,10-11H2,1-2H3 |
| InChIKey | NEKHOPLQKSGKJJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|