About 2-methyl-6-nonylpyridine
2-methyl-6-nonylpyridine (PubChem CID 165359246) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-methyl-6-nonylpyridine.
Molecular Properties
| Compound Name | 2-methyl-6-nonylpyridine |
| PubChem CID | 165359246 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-methyl-6-nonylpyridine |
| SMILES | CCCCCCCCCc1cccc(C)n1 |
| InChI | InChI=1S/C15H25N/c1-3-4-5-6-7-8-9-12-15-13-10-11-14(2)16-15/h10-11,13H,3-9,12H2,1-2H3 |
| InChIKey | RKEQYDXXOPXQDC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-nonylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-nonylpyridine?
The IUPAC name of 2-methyl-6-nonylpyridine (CID 165359246) is 2-methyl-6-nonylpyridine.
What is the SMILES notation for 2-methyl-6-nonylpyridine?
The canonical SMILES for 2-methyl-6-nonylpyridine is CCCCCCCCCc1cccc(C)n1.
What is the InChIKey of 2-methyl-6-nonylpyridine?
The InChIKey is RKEQYDXXOPXQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N/c1-3-4-5-6-7-8-9-12-15-13-10-11-14(2)16-15/h10-11,13H,3-9,12H2,1-2H3.
What are the key properties of 2-methyl-6-nonylpyridine?
2-methyl-6-nonylpyridine has a molecular weight of 219.37 g/mol, XLogP of 4.68, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-nonylpyridine is sourced from PubChem (CID 165359246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).