About 2-nitro-6-pentylpyridine
2-nitro-6-pentylpyridine (PubChem CID 141164963) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-nitro-6-pentylpyridine.
Molecular Properties
| Compound Name | 2-nitro-6-pentylpyridine |
| PubChem CID | 141164963 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-nitro-6-pentylpyridine |
| SMILES | CCCCCc1cccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H14N2O2/c1-2-3-4-6-9-7-5-8-10(11-9)12(13)14/h5,7-8H,2-4,6H2,1H3 |
| InChIKey | UIAHYAKUIJUOHD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-6-pentylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-6-pentylpyridine?
The IUPAC name of 2-nitro-6-pentylpyridine (CID 141164963) is 2-nitro-6-pentylpyridine.
What is the SMILES notation for 2-nitro-6-pentylpyridine?
The canonical SMILES for 2-nitro-6-pentylpyridine is CCCCCc1cccc([N+](=O)[O-])n1.
What is the InChIKey of 2-nitro-6-pentylpyridine?
The InChIKey is UIAHYAKUIJUOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-2-3-4-6-9-7-5-8-10(11-9)12(13)14/h5,7-8H,2-4,6H2,1H3.
What are the key properties of 2-nitro-6-pentylpyridine?
2-nitro-6-pentylpyridine has a molecular weight of 194.23 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-6-pentylpyridine is sourced from PubChem (CID 141164963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).