2-hexylpyridine;nitric acid

C11H18N2O3 — CID 174876958

IUPAC2-hexylpyridine;nitric acid
SMILESCCCCCCc1ccccn1.O=[N+]([O-])O
InChIInChI=1S/C11H17N.HNO3/c1-2-3-4-5-8-11-9-6-7-10-12-11;2-1(3)4/h6-7,9-10H,2-5,8H2,1H3;(H,2,3,4)
InChIKeyRWIFJIXMAFQQGK-UHFFFAOYSA-N
MW226.28 g/mol
LogP2.86
Rot. Bonds5

About 2-hexylpyridine;nitric acid

2-hexylpyridine;nitric acid (PubChem CID 174876958) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-hexylpyridine;nitric acid.

Molecular Properties

Compound Name2-hexylpyridine;nitric acid
PubChem CID174876958
Molecular FormulaC11H18N2O3
Molecular Weight226.28 g/mol
Exact Mass226.13
IUPAC Name2-hexylpyridine;nitric acid
SMILESCCCCCCc1ccccn1.O=[N+]([O-])O
InChIInChI=1S/C11H17N.HNO3/c1-2-3-4-5-8-11-9-6-7-10-12-11;2-1(3)4/h6-7,9-10H,2-5,8H2,1H3;(H,2,3,4)
InChIKeyRWIFJIXMAFQQGK-UHFFFAOYSA-N
XLogP2.86
TPSA76.26 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.28
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-hexylpyridine;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hexylpyridine;nitric acid?
The IUPAC name of 2-hexylpyridine;nitric acid (CID 174876958) is 2-hexylpyridine;nitric acid.
What is the SMILES notation for 2-hexylpyridine;nitric acid?
The canonical SMILES for 2-hexylpyridine;nitric acid is CCCCCCc1ccccn1.O=[N+]([O-])O.
What is the InChIKey of 2-hexylpyridine;nitric acid?
The InChIKey is RWIFJIXMAFQQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.HNO3/c1-2-3-4-5-8-11-9-6-7-10-12-11;2-1(3)4/h6-7,9-10H,2-5,8H2,1H3;(H,2,3,4).
What are the key properties of 2-hexylpyridine;nitric acid?
2-hexylpyridine;nitric acid has a molecular weight of 226.28 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylpyridine;nitric acid is sourced from PubChem (CID 174876958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).