About 2-hexylpyridine;nitric acid
2-hexylpyridine;nitric acid (PubChem CID 174876958) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-hexylpyridine;nitric acid.
Molecular Properties
| Compound Name | 2-hexylpyridine;nitric acid |
| PubChem CID | 174876958 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-hexylpyridine;nitric acid |
| SMILES | CCCCCCc1ccccn1.O=[N+]([O-])O |
| InChI | InChI=1S/C11H17N.HNO3/c1-2-3-4-5-8-11-9-6-7-10-12-11;2-1(3)4/h6-7,9-10H,2-5,8H2,1H3;(H,2,3,4) |
| InChIKey | RWIFJIXMAFQQGK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylpyridine;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylpyridine;nitric acid?
The IUPAC name of 2-hexylpyridine;nitric acid (CID 174876958) is 2-hexylpyridine;nitric acid.
What is the SMILES notation for 2-hexylpyridine;nitric acid?
The canonical SMILES for 2-hexylpyridine;nitric acid is CCCCCCc1ccccn1.O=[N+]([O-])O.
What is the InChIKey of 2-hexylpyridine;nitric acid?
The InChIKey is RWIFJIXMAFQQGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.HNO3/c1-2-3-4-5-8-11-9-6-7-10-12-11;2-1(3)4/h6-7,9-10H,2-5,8H2,1H3;(H,2,3,4).
What are the key properties of 2-hexylpyridine;nitric acid?
2-hexylpyridine;nitric acid has a molecular weight of 226.28 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylpyridine;nitric acid is sourced from PubChem (CID 174876958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).