About 6-pyridin-2-ylhexanoate
6-pyridin-2-ylhexanoate (PubChem CID 7109691) has the molecular formula C11H14NO2-
and a molecular weight of 192.24 g/mol. Its IUPAC name is 6-pyridin-2-ylhexanoate.
Molecular Properties
| Compound Name | 6-pyridin-2-ylhexanoate |
| PubChem CID | 7109691 |
| Molecular Formula | C11H14NO2- |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-pyridin-2-ylhexanoate |
| SMILES | O=C([O-])CCCCCc1ccccn1 |
| InChI | InChI=1S/C11H15NO2/c13-11(14)8-3-1-2-6-10-7-4-5-9-12-10/h4-5,7,9H,1-3,6,8H2,(H,13,14)/p-1 |
| InChIKey | WSMRJBYOIBBOQN-UHFFFAOYSA-M |
| XLogP | 0.93 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-pyridin-2-ylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyridin-2-ylhexanoate?
The IUPAC name of 6-pyridin-2-ylhexanoate (CID 7109691) is 6-pyridin-2-ylhexanoate.
What is the SMILES notation for 6-pyridin-2-ylhexanoate?
The canonical SMILES for 6-pyridin-2-ylhexanoate is O=C([O-])CCCCCc1ccccn1.
What is the InChIKey of 6-pyridin-2-ylhexanoate?
The InChIKey is WSMRJBYOIBBOQN-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15NO2/c13-11(14)8-3-1-2-6-10-7-4-5-9-12-10/h4-5,7,9H,1-3,6,8H2,(H,13,14)/p-1.
What are the key properties of 6-pyridin-2-ylhexanoate?
6-pyridin-2-ylhexanoate has a molecular weight of 192.24 g/mol, XLogP of 0.93, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyridin-2-ylhexanoate is sourced from PubChem (CID 7109691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).