About 2-(methoxymethyl)-1,8-naphthyridine
2-(methoxymethyl)-1,8-naphthyridine (PubChem CID 154147005) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(methoxymethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-1,8-naphthyridine |
| PubChem CID | 154147005 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-(methoxymethyl)-1,8-naphthyridine |
| SMILES | COCc1ccc2cccnc2n1 |
| InChI | InChI=1S/C10H10N2O/c1-13-7-9-5-4-8-3-2-6-11-10(8)12-9/h2-6H,7H2,1H3 |
| InChIKey | ZUBBZGWNNHSTLJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methoxymethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-1,8-naphthyridine?
The IUPAC name of 2-(methoxymethyl)-1,8-naphthyridine (CID 154147005) is 2-(methoxymethyl)-1,8-naphthyridine.
What is the SMILES notation for 2-(methoxymethyl)-1,8-naphthyridine?
The canonical SMILES for 2-(methoxymethyl)-1,8-naphthyridine is COCc1ccc2cccnc2n1.
What is the InChIKey of 2-(methoxymethyl)-1,8-naphthyridine?
The InChIKey is ZUBBZGWNNHSTLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-13-7-9-5-4-8-3-2-6-11-10(8)12-9/h2-6H,7H2,1H3.
What are the key properties of 2-(methoxymethyl)-1,8-naphthyridine?
2-(methoxymethyl)-1,8-naphthyridine has a molecular weight of 174.20 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-1,8-naphthyridine is sourced from PubChem (CID 154147005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).