C10H10N2O — CID 154147005
2-(methoxymethyl)-1,8-naphthyridine (PubChem CID 154147005) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-(methoxymethyl)-1,8-naphthyridine.
| Compound Name | 2-(methoxymethyl)-1,8-naphthyridine |
|---|---|
| PubChem CID | 154147005 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-(methoxymethyl)-1,8-naphthyridine |
| SMILES | COCc1ccc2cccnc2n1 |
| InChI | InChI=1S/C10H10N2O/c1-13-7-9-5-4-8-3-2-6-11-10(8)12-9/h2-6H,7H2,1H3 |
| InChIKey | ZUBBZGWNNHSTLJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |